C24H34N2O5 — CID 118511940
1-tert-butyl-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropyl]pyrrole-3-carboxylic acid (PubChem CID 118511940) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is 1-tert-butyl-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropyl]pyrrole-3-carboxylic acid.
| Compound Name | 1-tert-butyl-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 118511940 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 1-tert-butyl-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropyl]pyrrole-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCOCc1ccccc1)c1c(C(=O)O)ccn1C(C)(C)C |
| InChI | InChI=1S/C24H34N2O5/c1-23(2,3)26-14-12-18(21(27)28)20(26)19(25-22(29)31-24(4,5)6)13-15-30-16-17-10-8-7-9-11-17/h7-12,14,19H,13,15-16H2,1-6H3,(H,25,29)(H,27,28) |
| InChIKey | PDMDLJHQJVUXRS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|