C16H22O3 — CID 11851361
(1S)-1-[(1S,4R)-1,4-dimethyl-4-(phenylmethoxymethyl)cyclobut-2-en-1-yl]ethane-1,2-diol (PubChem CID 11851361) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1S)-1-[(1S,4R)-1,4-dimethyl-4-(phenylmethoxymethyl)cyclobut-2-en-1-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(1S,4R)-1,4-dimethyl-4-(phenylmethoxymethyl)cyclobut-2-en-1-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 11851361 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (1S)-1-[(1S,4R)-1,4-dimethyl-4-(phenylmethoxymethyl)cyclobut-2-en-1-yl]ethane-1,2-diol |
| SMILES | C[C@@]1(COCc2ccccc2)C=C[C@]1(C)[C@H](O)CO |
| InChI | InChI=1S/C16H22O3/c1-15(8-9-16(15,2)14(18)10-17)12-19-11-13-6-4-3-5-7-13/h3-9,14,17-18H,10-12H2,1-2H3/t14-,15+,16-/m1/s1 |
| InChIKey | OZBKLEVRVZOFJH-OWCLPIDISA-N |
| XLogP | 2.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|