C16H15Cl2N5S — CID 118515163
2-chloro-4-[4-chloro-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile (PubChem CID 118515163) has the molecular formula C16H15Cl2N5S and a molecular weight of 380.30 g/mol. Its IUPAC name is 2-chloro-4-[4-chloro-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile.
| Compound Name | 2-chloro-4-[4-chloro-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 118515163 |
| Molecular Formula | C16H15Cl2N5S |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 2-chloro-4-[4-chloro-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile |
| SMILES | CN1CCN(c2ncc(Sc3ccc(C#N)c(Cl)c3)c(Cl)n2)CC1 |
| InChI | InChI=1S/C16H15Cl2N5S/c1-22-4-6-23(7-5-22)16-20-10-14(15(18)21-16)24-12-3-2-11(9-19)13(17)8-12/h2-3,8,10H,4-7H2,1H3 |
| InChIKey | PEJDBESCURDPEN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |