C17H18ClN5S — CID 130328296
2-chloro-4-[4-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile (PubChem CID 130328296) has the molecular formula C17H18ClN5S and a molecular weight of 359.89 g/mol. Its IUPAC name is 2-chloro-4-[4-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile.
| Compound Name | 2-chloro-4-[4-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 130328296 |
| Molecular Formula | C17H18ClN5S |
| Molecular Weight | 359.89 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-chloro-4-[4-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile |
| SMILES | Cc1nc(N2CCN(C)CC2)ncc1Sc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C17H18ClN5S/c1-12-16(24-14-4-3-13(10-19)15(18)9-14)11-20-17(21-12)23-7-5-22(2)6-8-23/h3-4,9,11H,5-8H2,1-2H3 |
| InChIKey | PHOKCBIHRUFTFW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |