C11H7N3O2S — CID 118515202
4-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfanyl]benzonitrile (PubChem CID 118515202) has the molecular formula C11H7N3O2S and a molecular weight of 245.26 g/mol. Its IUPAC name is 4-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfanyl]benzonitrile.
| Compound Name | 4-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfanyl]benzonitrile |
|---|---|
| PubChem CID | 118515202 |
| Molecular Formula | C11H7N3O2S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 4-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfanyl]benzonitrile |
| SMILES | N#Cc1ccc(Sc2c[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C11H7N3O2S/c12-5-7-1-3-8(4-2-7)17-9-6-13-11(16)14-10(9)15/h1-4,6H,(H2,13,14,15,16) |
| InChIKey | QWBXUQXPTODUGR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |