C15H19N3O2S — CID 2366350
6-amino-1-butyl-5-(4-methylphenyl)sulfanylpyrimidine-2,4-dione (PubChem CID 2366350) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 6-amino-1-butyl-5-(4-methylphenyl)sulfanylpyrimidine-2,4-dione.
| Compound Name | 6-amino-1-butyl-5-(4-methylphenyl)sulfanylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2366350 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 6-amino-1-butyl-5-(4-methylphenyl)sulfanylpyrimidine-2,4-dione |
| SMILES | CCCCn1c(N)c(Sc2ccc(C)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H19N3O2S/c1-3-4-9-18-13(16)12(14(19)17-15(18)20)21-11-7-5-10(2)6-8-11/h5-8H,3-4,9,16H2,1-2H3,(H,17,19,20) |
| InChIKey | BRTRHNYBXMPWHT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |