C13H16N4O3 — CID 118516808
methyl 3-(2-benzamidoethyl)-1,2-dihydrotriazole-5-carboxylate (PubChem CID 118516808) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is methyl 3-(2-benzamidoethyl)-1,2-dihydrotriazole-5-carboxylate.
| Compound Name | methyl 3-(2-benzamidoethyl)-1,2-dihydrotriazole-5-carboxylate |
|---|---|
| PubChem CID | 118516808 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | methyl 3-(2-benzamidoethyl)-1,2-dihydrotriazole-5-carboxylate |
| SMILES | COC(=O)C1=CN(CCNC(=O)c2ccccc2)NN1 |
| InChI | InChI=1S/C13H16N4O3/c1-20-13(19)11-9-17(16-15-11)8-7-14-12(18)10-5-3-2-4-6-10/h2-6,9,15-16H,7-8H2,1H3,(H,14,18) |
| InChIKey | MTRODTXVIOFGEV-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |