C19H25N — CID 118519008
1-[(2E,4Z)-2,3-dimethylhepta-2,4,6-trienyl]-7-methyl-3,4-dihydro-2H-quinoline (PubChem CID 118519008) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-[(2E,4Z)-2,3-dimethylhepta-2,4,6-trienyl]-7-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[(2E,4Z)-2,3-dimethylhepta-2,4,6-trienyl]-7-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 118519008 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 1-[(2E,4Z)-2,3-dimethylhepta-2,4,6-trienyl]-7-methyl-3,4-dihydro-2H-quinoline |
| SMILES | C=C/C=C\C(C)=C(/C)CN1CCCc2ccc(C)cc21 |
| InChI | InChI=1S/C19H25N/c1-5-6-8-16(3)17(4)14-20-12-7-9-18-11-10-15(2)13-19(18)20/h5-6,8,10-11,13H,1,7,9,12,14H2,2-4H3/b8-6-,17-16+ |
| InChIKey | BFCDSNMPYXRFRG-ZWKHAXJNSA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|