C19H21N3O3 — CID 118520233
N-[4-(4-methylphenyl)butyl]-2-oxo-1,3-benzoxazole-3-carbohydrazide (PubChem CID 118520233) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[4-(4-methylphenyl)butyl]-2-oxo-1,3-benzoxazole-3-carbohydrazide.
| Compound Name | N-[4-(4-methylphenyl)butyl]-2-oxo-1,3-benzoxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 118520233 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[4-(4-methylphenyl)butyl]-2-oxo-1,3-benzoxazole-3-carbohydrazide |
| SMILES | Cc1ccc(CCCCN(N)C(=O)n2c(=O)oc3ccccc32)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-14-9-11-15(12-10-14)6-4-5-13-21(20)18(23)22-16-7-2-3-8-17(16)25-19(22)24/h2-3,7-12H,4-6,13,20H2,1H3 |
| InChIKey | NXPRMUNHVSHEIA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|