C34H43N3O8S — CID 118521017
3,5-dioxatricyclo[5.2.1.04,8]decan-10-yl N-[(2S,3R)-4-[[4-(2-ethyl-1,3-oxazol-5-yl)phenyl]sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 118521017) has the molecular formula C34H43N3O8S and a molecular weight of 653.80 g/mol. Its IUPAC name is 3,5-dioxatricyclo[5.2.1.04,8]decan-10-yl N-[(2S,3R)-4-[[4-(2-ethyl-1,3-oxazol-5-yl)phenyl]sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 3,5-dioxatricyclo[5.2.1.04,8]decan-10-yl N-[(2S,3R)-4-[[4-(2-ethyl-1,3-oxazol-5-yl)phenyl]sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 118521017 |
| Molecular Formula | C34H43N3O8S |
| Molecular Weight | 653.80 g/mol |
| Exact Mass | 653.28 |
| IUPAC Name | 3,5-dioxatricyclo[5.2.1.04,8]decan-10-yl N-[(2S,3R)-4-[[4-(2-ethyl-1,3-oxazol-5-yl)phenyl]sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CCc1ncc(-c2ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc3ccccc3)NC(=O)OC3C4COC5OCC3C5C4)cc2)o1 |
| InChI | InChI=1S/C34H43N3O8S/c1-4-31-35-16-30(44-31)23-10-12-25(13-11-23)46(40,41)37(17-21(2)3)18-29(38)28(14-22-8-6-5-7-9-22)36-34(39)45-32-24-15-26-27(32)20-43-33(26)42-19-24/h5-13,16,21,24,26-29,32-33,38H,4,14-15,17-20H2,1-3H3,(H,36,39)/t24?,26?,27?,28-,29+,32?,33?/m0/s1 |
| InChIKey | HCXYGYKVNLIBHT-ZIWXPSPKSA-N |
| XLogP | 4.26 |
| TPSA | 140.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.80 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |