C16H17BrN3O2+ — CID 118523350
8-bromo-3-methyl-3-(oxan-4-yl)-1H-imidazo[4,5-c]quinolin-3-ium-2-one (PubChem CID 118523350) has the molecular formula C16H17BrN3O2+ and a molecular weight of 363.24 g/mol. Its IUPAC name is 8-bromo-3-methyl-3-(oxan-4-yl)-1H-imidazo[4,5-c]quinolin-3-ium-2-one.
| Compound Name | 8-bromo-3-methyl-3-(oxan-4-yl)-1H-imidazo[4,5-c]quinolin-3-ium-2-one |
|---|---|
| PubChem CID | 118523350 |
| Molecular Formula | C16H17BrN3O2+ |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 8-bromo-3-methyl-3-(oxan-4-yl)-1H-imidazo[4,5-c]quinolin-3-ium-2-one |
| SMILES | C[N+]1(C2CCOCC2)C(=O)Nc2c1cnc1ccc(Br)cc21 |
| InChI | InChI=1S/C16H16BrN3O2/c1-20(11-4-6-22-7-5-11)14-9-18-13-3-2-10(17)8-12(13)15(14)19-16(20)21/h2-3,8-9,11H,4-7H2,1H3/p+1 |
| InChIKey | PFZZASUZHKOBBD-UHFFFAOYSA-O |
| XLogP | 3.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|