C21H22F3NO3 — CID 118524831
[(1R)-3-[[4-[3-(trifluoromethyl)phenyl]phenyl]methoxy]cyclohexyl]carbamic acid (PubChem CID 118524831) has the molecular formula C21H22F3NO3 and a molecular weight of 393.41 g/mol. Its IUPAC name is [(1R)-3-[[4-[3-(trifluoromethyl)phenyl]phenyl]methoxy]cyclohexyl]carbamic acid.
| Compound Name | [(1R)-3-[[4-[3-(trifluoromethyl)phenyl]phenyl]methoxy]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 118524831 |
| Molecular Formula | C21H22F3NO3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [(1R)-3-[[4-[3-(trifluoromethyl)phenyl]phenyl]methoxy]cyclohexyl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CCCC(OCc2ccc(-c3cccc(C(F)(F)F)c3)cc2)C1 |
| InChI | InChI=1S/C21H22F3NO3/c22-21(23,24)17-4-1-3-16(11-17)15-9-7-14(8-10-15)13-28-19-6-2-5-18(12-19)25-20(26)27/h1,3-4,7-11,18-19,25H,2,5-6,12-13H2,(H,26,27)/t18-,19?/m1/s1 |
| InChIKey | HZNNLTVFLLLUHQ-MRTLOADZSA-N |
| XLogP | 5.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |