About azacyclododecane-2,5-dione
azacyclododecane-2,5-dione (PubChem CID 118524921) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is azacyclododecane-2,5-dione.
Molecular Properties
| Compound Name | azacyclododecane-2,5-dione |
| PubChem CID | 118524921 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | azacyclododecane-2,5-dione |
| SMILES | O=C1CCCCCCCNC(=O)CC1 |
| InChI | InChI=1S/C11H19NO2/c13-10-6-4-2-1-3-5-9-12-11(14)8-7-10/h1-9H2,(H,12,14) |
| InChIKey | IXVPWHVSVIJODJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azacyclododecane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azacyclododecane-2,5-dione?
The IUPAC name of azacyclododecane-2,5-dione (CID 118524921) is azacyclododecane-2,5-dione.
What is the SMILES notation for azacyclododecane-2,5-dione?
The canonical SMILES for azacyclododecane-2,5-dione is O=C1CCCCCCCNC(=O)CC1.
What is the InChIKey of azacyclododecane-2,5-dione?
The InChIKey is IXVPWHVSVIJODJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c13-10-6-4-2-1-3-5-9-12-11(14)8-7-10/h1-9H2,(H,12,14).
What are the key properties of azacyclododecane-2,5-dione?
azacyclododecane-2,5-dione has a molecular weight of 197.28 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azacyclododecane-2,5-dione is sourced from PubChem (CID 118524921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).