C19H33N3O6 — CID 170397166
1,12-dihydroxy-1,6,12-triazacyclodocosane-2,5,13,16-tetrone (PubChem CID 170397166) has the molecular formula C19H33N3O6 and a molecular weight of 399.49 g/mol. Its IUPAC name is 1,12-dihydroxy-1,6,12-triazacyclodocosane-2,5,13,16-tetrone.
| Compound Name | 1,12-dihydroxy-1,6,12-triazacyclodocosane-2,5,13,16-tetrone |
|---|---|
| PubChem CID | 170397166 |
| Molecular Formula | C19H33N3O6 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 1,12-dihydroxy-1,6,12-triazacyclodocosane-2,5,13,16-tetrone |
| SMILES | O=C1CCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(=O)CC1 |
| InChI | InChI=1S/C19H33N3O6/c23-16-8-4-1-2-6-14-22(28)19(26)12-10-17(24)20-13-5-3-7-15-21(27)18(25)11-9-16/h27-28H,1-15H2,(H,20,24) |
| InChIKey | XZSUPEKLJUFHOG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|