C17H30N4O6 — CID 102234583
1,11-dihydroxy-1,6,11,16-tetrazacyclohenicosane-2,5,12,15-tetrone (PubChem CID 102234583) has the molecular formula C17H30N4O6 and a molecular weight of 386.45 g/mol. Its IUPAC name is 1,11-dihydroxy-1,6,11,16-tetrazacyclohenicosane-2,5,12,15-tetrone.
| Compound Name | 1,11-dihydroxy-1,6,11,16-tetrazacyclohenicosane-2,5,12,15-tetrone |
|---|---|
| PubChem CID | 102234583 |
| Molecular Formula | C17H30N4O6 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1,11-dihydroxy-1,6,11,16-tetrazacyclohenicosane-2,5,12,15-tetrone |
| SMILES | O=C1CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCN1 |
| InChI | InChI=1S/C17H30N4O6/c22-14-6-9-17(25)21(27)13-5-3-11-19-15(23)7-8-16(24)20(26)12-4-1-2-10-18-14/h26-27H,1-13H2,(H,18,22)(H,19,23) |
| InChIKey | XOHMZXNFDYUBOA-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|