C21H36N4O7 — CID 163117483
1,12-dihydroxy-1,6,12,19-tetrazacyclopentacosane-2,5,13,15,18-pentone (PubChem CID 163117483) has the molecular formula C21H36N4O7 and a molecular weight of 456.54 g/mol. Its IUPAC name is 1,12-dihydroxy-1,6,12,19-tetrazacyclopentacosane-2,5,13,15,18-pentone.
| Compound Name | 1,12-dihydroxy-1,6,12,19-tetrazacyclopentacosane-2,5,13,15,18-pentone |
|---|---|
| PubChem CID | 163117483 |
| Molecular Formula | C21H36N4O7 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 1,12-dihydroxy-1,6,12,19-tetrazacyclopentacosane-2,5,13,15,18-pentone |
| SMILES | O=C1CCC(=O)NCCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(=O)C1 |
| InChI | InChI=1S/C21H36N4O7/c26-17-8-9-18(27)22-12-4-1-2-6-14-24(31)20(29)11-10-19(28)23-13-5-3-7-15-25(32)21(30)16-17/h31-32H,1-16H2,(H,22,27)(H,23,28) |
| InChIKey | AIFMRORJEYCZHN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|