C28H49N5O9 — CID 163581246
6,17,28-trihydroxy-1,6,12,17,23-pentazacyclotritriacontane-2,5,13,16,24,27-hexone (PubChem CID 163581246) has the molecular formula C28H49N5O9 and a molecular weight of 599.73 g/mol. Its IUPAC name is 6,17,28-trihydroxy-1,6,12,17,23-pentazacyclotritriacontane-2,5,13,16,24,27-hexone.
| Compound Name | 6,17,28-trihydroxy-1,6,12,17,23-pentazacyclotritriacontane-2,5,13,16,24,27-hexone |
|---|---|
| PubChem CID | 163581246 |
| Molecular Formula | C28H49N5O9 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.35 |
| IUPAC Name | 6,17,28-trihydroxy-1,6,12,17,23-pentazacyclotritriacontane-2,5,13,16,24,27-hexone |
| SMILES | O=C1CCC(=O)C(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN1 |
| InChI | InChI=1S/C28H49N5O9/c34-22-10-4-1-5-17-30-25(37)13-15-27(39)33(42)21-9-3-7-19-31-26(38)14-16-28(40)32(41)20-8-2-6-18-29-24(36)12-11-23(22)35/h22,34,41-42H,1-21H2,(H,29,36)(H,30,37)(H,31,38) |
| InChIKey | TZHAVIWLPDGYAH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 205.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|