C7H12N4O3 — CID 118525654
[(2S)-3-hydroxy-4-(2H-triazol-4-yl)butan-2-yl]carbamic acid (PubChem CID 118525654) has the molecular formula C7H12N4O3 and a molecular weight of 200.20 g/mol. Its IUPAC name is [(2S)-3-hydroxy-4-(2H-triazol-4-yl)butan-2-yl]carbamic acid.
| Compound Name | [(2S)-3-hydroxy-4-(2H-triazol-4-yl)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118525654 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | [(2S)-3-hydroxy-4-(2H-triazol-4-yl)butan-2-yl]carbamic acid |
| SMILES | C[C@H](NC(=O)O)C(O)Cc1cn[nH]n1 |
| InChI | InChI=1S/C7H12N4O3/c1-4(9-7(13)14)6(12)2-5-3-8-11-10-5/h3-4,6,9,12H,2H2,1H3,(H,13,14)(H,8,10,11)/t4-,6?/m0/s1 |
| InChIKey | WZNSHJPQSIMWIJ-VKZKZBKNSA-N |
| XLogP | -0.64 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |