C6H12N2O4 — CID 118525653
[(2S)-4-formamido-3-hydroxybutan-2-yl]carbamic acid (PubChem CID 118525653) has the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. Its IUPAC name is [(2S)-4-formamido-3-hydroxybutan-2-yl]carbamic acid.
| Compound Name | [(2S)-4-formamido-3-hydroxybutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118525653 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | [(2S)-4-formamido-3-hydroxybutan-2-yl]carbamic acid |
| SMILES | C[C@H](NC(=O)O)C(O)CNC=O |
| InChI | InChI=1S/C6H12N2O4/c1-4(8-6(11)12)5(10)2-7-3-9/h3-5,8,10H,2H2,1H3,(H,7,9)(H,11,12)/t4-,5?/m0/s1 |
| InChIKey | LNSHQEYOVCNRTK-ROLXFIACSA-N |
| XLogP | -1.25 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|