C6H12N2O3 — CID 89251915
3-formamido-2-hydroxy-N,N-dimethylpropanamide (PubChem CID 89251915) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is 3-formamido-2-hydroxy-N,N-dimethylpropanamide.
| Compound Name | 3-formamido-2-hydroxy-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 89251915 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 3-formamido-2-hydroxy-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)C(O)CNC=O |
| InChI | InChI=1S/C6H12N2O3/c1-8(2)6(11)5(10)3-7-4-9/h4-5,10H,3H2,1-2H3,(H,7,9) |
| InChIKey | FABQONYKDWBJOV-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|