C19H17ClF4 — CID 118526276
6-(chloromethyl)-5-fluoro-3,3-dimethyl-1-[2-(trifluoromethyl)phenyl]-1,2-dihydroindene (PubChem CID 118526276) has the molecular formula C19H17ClF4 and a molecular weight of 356.79 g/mol. Its IUPAC name is 6-(chloromethyl)-5-fluoro-3,3-dimethyl-1-[2-(trifluoromethyl)phenyl]-1,2-dihydroindene.
| Compound Name | 6-(chloromethyl)-5-fluoro-3,3-dimethyl-1-[2-(trifluoromethyl)phenyl]-1,2-dihydroindene |
|---|---|
| PubChem CID | 118526276 |
| Molecular Formula | C19H17ClF4 |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 6-(chloromethyl)-5-fluoro-3,3-dimethyl-1-[2-(trifluoromethyl)phenyl]-1,2-dihydroindene |
| SMILES | CC1(C)CC(c2ccccc2C(F)(F)F)c2cc(CCl)c(F)cc21 |
| InChI | InChI=1S/C19H17ClF4/c1-18(2)9-14(12-5-3-4-6-15(12)19(22,23)24)13-7-11(10-20)17(21)8-16(13)18/h3-8,14H,9-10H2,1-2H3 |
| InChIKey | BANGOCFPIOCSSX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|