C20H27N3O2S — CID 118527402
4-methyl-N-piperidin-4-yl-N-(3-pyridin-3-ylpropyl)benzenesulfonamide (PubChem CID 118527402) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 4-methyl-N-piperidin-4-yl-N-(3-pyridin-3-ylpropyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-piperidin-4-yl-N-(3-pyridin-3-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118527402 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 4-methyl-N-piperidin-4-yl-N-(3-pyridin-3-ylpropyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCc2cccnc2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C20H27N3O2S/c1-17-6-8-20(9-7-17)26(24,25)23(19-10-13-21-14-11-19)15-3-5-18-4-2-12-22-16-18/h2,4,6-9,12,16,19,21H,3,5,10-11,13-15H2,1H3 |
| InChIKey | QTBXCCNHWZPCTG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |