C19H29N5O2S2 — CID 134446962
N-piperidin-4-yl-4-(2-sulfanylpropan-2-yl)-N-[3-(1,2,4-triazol-4-yl)propyl]benzenesulfonamide (PubChem CID 134446962) has the molecular formula C19H29N5O2S2 and a molecular weight of 423.61 g/mol. Its IUPAC name is N-piperidin-4-yl-4-(2-sulfanylpropan-2-yl)-N-[3-(1,2,4-triazol-4-yl)propyl]benzenesulfonamide.
| Compound Name | N-piperidin-4-yl-4-(2-sulfanylpropan-2-yl)-N-[3-(1,2,4-triazol-4-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134446962 |
| Molecular Formula | C19H29N5O2S2 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-piperidin-4-yl-4-(2-sulfanylpropan-2-yl)-N-[3-(1,2,4-triazol-4-yl)propyl]benzenesulfonamide |
| SMILES | CC(C)(S)c1ccc(S(=O)(=O)N(CCCn2cnnc2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C19H29N5O2S2/c1-19(2,27)16-4-6-18(7-5-16)28(25,26)24(17-8-10-20-11-9-17)13-3-12-23-14-21-22-15-23/h4-7,14-15,17,20,27H,3,8-13H2,1-2H3 |
| InChIKey | MQKKRPGTAQOGGW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|