About 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide
4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide (PubChem CID 70645932) has the molecular formula C26H37N3O2S
and a molecular weight of 455.67 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide |
| PubChem CID | 70645932 |
| Molecular Formula | C26H37N3O2S |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N(CCCN2CCc3ccccc32)C2CCNCC2)cc1 |
| InChI | InChI=1S/C26H37N3O2S/c1-26(2,3)22-9-11-24(12-10-22)32(30,31)29(23-13-16-27-17-14-23)19-6-18-28-20-15-21-7-4-5-8-25(21)28/h4-5,7-12,23,27H,6,13-20H2,1-3H3 |
| InChIKey | KVESLTNOQPLVDG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide?
The IUPAC name of 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide (CID 70645932) is 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide.
What is the SMILES notation for 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide?
The canonical SMILES for 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide is CC(C)(C)c1ccc(S(=O)(=O)N(CCCN2CCc3ccccc32)C2CCNCC2)cc1.
What is the InChIKey of 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide?
The InChIKey is KVESLTNOQPLVDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H37N3O2S/c1-26(2,3)22-9-11-24(12-10-22)32(30,31)29(23-13-16-27-17-14-23)19-6-18-28-20-15-21-7-4-5-8-25(21)28/h4-5,7-12,23,27H,6,13-20H2,1-3H3.
What are the key properties of 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide?
4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide has a molecular weight of 455.67 g/mol, XLogP of 4.18, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-[3-(2,3-dihydroindol-1-yl)propyl]-N-piperidin-4-ylbenzenesulfonamide is sourced from PubChem (CID 70645932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).