C27H22N2O3S — CID 118532933
methyl 3,5-bis(5-phenyl-1H-pyrrol-2-yl)benzenesulfonate (PubChem CID 118532933) has the molecular formula C27H22N2O3S and a molecular weight of 454.55 g/mol. Its IUPAC name is methyl 3,5-bis(5-phenyl-1H-pyrrol-2-yl)benzenesulfonate.
| Compound Name | methyl 3,5-bis(5-phenyl-1H-pyrrol-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 118532933 |
| Molecular Formula | C27H22N2O3S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | methyl 3,5-bis(5-phenyl-1H-pyrrol-2-yl)benzenesulfonate |
| SMILES | COS(=O)(=O)c1cc(-c2ccc(-c3ccccc3)[nH]2)cc(-c2ccc(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C27H22N2O3S/c1-32-33(30,31)23-17-21(26-14-12-24(28-26)19-8-4-2-5-9-19)16-22(18-23)27-15-13-25(29-27)20-10-6-3-7-11-20/h2-18,28-29H,1H3 |
| InChIKey | WMSCTWDBFJCTEF-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|