C15H17F3N4O — CID 118535078
1-[(1S)-1-(1H-imidazol-2-yl)-2-methylpropyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 118535078) has the molecular formula C15H17F3N4O and a molecular weight of 326.32 g/mol. Its IUPAC name is 1-[(1S)-1-(1H-imidazol-2-yl)-2-methylpropyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1S)-1-(1H-imidazol-2-yl)-2-methylpropyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 118535078 |
| Molecular Formula | C15H17F3N4O |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-[(1S)-1-(1H-imidazol-2-yl)-2-methylpropyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CC(C)[C@H](NC(=O)Nc1ccc(C(F)(F)F)cc1)c1ncc[nH]1 |
| InChI | InChI=1S/C15H17F3N4O/c1-9(2)12(13-19-7-8-20-13)22-14(23)21-11-5-3-10(4-6-11)15(16,17)18/h3-9,12H,1-2H3,(H,19,20)(H2,21,22,23)/t12-/m0/s1 |
| InChIKey | TZHMDVMFTQYQJM-LBPRGKRZSA-N |
| XLogP | 3.95 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |