C26H35NO3S — CID 11853576
3-[4-[2-(2-hydroxyethylamino)ethoxy]-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one (PubChem CID 11853576) has the molecular formula C26H35NO3S and a molecular weight of 441.64 g/mol. Its IUPAC name is 3-[4-[2-(2-hydroxyethylamino)ethoxy]-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one.
| Compound Name | 3-[4-[2-(2-hydroxyethylamino)ethoxy]-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
|---|---|
| PubChem CID | 11853576 |
| Molecular Formula | C26H35NO3S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 3-[4-[2-(2-hydroxyethylamino)ethoxy]-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
| SMILES | Cc1cc(CCC(=O)c2sc(C)c3c2C[C@@H]2[C@H]3C2(C)C)cc(C)c1OCCNCCO |
| InChI | InChI=1S/C26H35NO3S/c1-15-12-18(13-16(2)24(15)30-11-9-27-8-10-28)6-7-21(29)25-19-14-20-23(26(20,4)5)22(19)17(3)31-25/h12-13,20,23,27-28H,6-11,14H2,1-5H3/t20-,23-/m1/s1 |
| InChIKey | QEKPYOYQQSXBKE-NFBKMPQASA-N |
| XLogP | 4.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|