C27H37NO4S — CID 67416689
3-[4-[2-(1,3-dihydroxypropan-2-ylamino)ethoxy]-3,5-dimethylphenyl]-1-[(4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one (PubChem CID 67416689) has the molecular formula C27H37NO4S and a molecular weight of 471.66 g/mol. Its IUPAC name is 3-[4-[2-(1,3-dihydroxypropan-2-ylamino)ethoxy]-3,5-dimethylphenyl]-1-[(4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one.
| Compound Name | 3-[4-[2-(1,3-dihydroxypropan-2-ylamino)ethoxy]-3,5-dimethylphenyl]-1-[(4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
|---|---|
| PubChem CID | 67416689 |
| Molecular Formula | C27H37NO4S |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 3-[4-[2-(1,3-dihydroxypropan-2-ylamino)ethoxy]-3,5-dimethylphenyl]-1-[(4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
| SMILES | Cc1cc(CCC(=O)c2sc(C)c3c2C[C@@H]2C3C2(C)C)cc(C)c1OCCNC(CO)CO |
| InChI | InChI=1S/C27H37NO4S/c1-15-10-18(11-16(2)25(15)32-9-8-28-19(13-29)14-30)6-7-22(31)26-20-12-21-24(27(21,4)5)23(20)17(3)33-26/h10-11,19,21,24,28-30H,6-9,12-14H2,1-5H3/t21-,24?/m1/s1 |
| InChIKey | KDBORRFWDVVNHZ-CILPGNKCSA-N |
| XLogP | 4.11 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|