C22H26ClNO4S — CID 11618956
(2S,4R)-N-[[2-chloro-4-[(2R)-2,3-dihydroxypropoxy]phenyl]methyl]-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-diene-7-carboxamide (PubChem CID 11618956) has the molecular formula C22H26ClNO4S and a molecular weight of 435.97 g/mol. Its IUPAC name is (2S,4R)-N-[[2-chloro-4-[(2R)-2,3-dihydroxypropoxy]phenyl]methyl]-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-diene-7-carboxamide.
| Compound Name | (2S,4R)-N-[[2-chloro-4-[(2R)-2,3-dihydroxypropoxy]phenyl]methyl]-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-diene-7-carboxamide |
|---|---|
| PubChem CID | 11618956 |
| Molecular Formula | C22H26ClNO4S |
| Molecular Weight | 435.97 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (2S,4R)-N-[[2-chloro-4-[(2R)-2,3-dihydroxypropoxy]phenyl]methyl]-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-diene-7-carboxamide |
| SMILES | Cc1sc(C(=O)NCc2ccc(OC[C@H](O)CO)cc2Cl)c2c1[C@H]1[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C22H26ClNO4S/c1-11-18-15(7-16-19(18)22(16,2)3)20(29-11)21(27)24-8-12-4-5-14(6-17(12)23)28-10-13(26)9-25/h4-6,13,16,19,25-26H,7-10H2,1-3H3,(H,24,27)/t13-,16-,19-/m1/s1 |
| InChIKey | ZNPQVYHCFFJTND-VVFCZOMOSA-N |
| XLogP | 3.67 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.97 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |