C23H29NO5S — CID 11633389
(2S,4R)-N-[[4-[(2S)-2,3-dihydroxypropoxy]-2-methoxyphenyl]methyl]-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-diene-7-carboxamide (PubChem CID 11633389) has the molecular formula C23H29NO5S and a molecular weight of 431.55 g/mol. Its IUPAC name is (2S,4R)-N-[[4-[(2S)-2,3-dihydroxypropoxy]-2-methoxyphenyl]methyl]-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-diene-7-carboxamide.
| Compound Name | (2S,4R)-N-[[4-[(2S)-2,3-dihydroxypropoxy]-2-methoxyphenyl]methyl]-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-diene-7-carboxamide |
|---|---|
| PubChem CID | 11633389 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (2S,4R)-N-[[4-[(2S)-2,3-dihydroxypropoxy]-2-methoxyphenyl]methyl]-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-diene-7-carboxamide |
| SMILES | COc1cc(OC[C@@H](O)CO)ccc1CNC(=O)c1sc(C)c2c1C[C@@H]1[C@H]2C1(C)C |
| InChI | InChI=1S/C23H29NO5S/c1-12-19-16(8-17-20(19)23(17,2)3)21(30-12)22(27)24-9-13-5-6-15(7-18(13)28-4)29-11-14(26)10-25/h5-7,14,17,20,25-26H,8-11H2,1-4H3,(H,24,27)/t14-,17+,20+/m0/s1 |
| InChIKey | NVCNEAUUFRHSBJ-JNAXZKDPSA-N |
| XLogP | 3.02 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |