C22H27NO4S — CID 11682795
(2S,4R)-N-[[4-[(2S)-2,3-dihydroxypropoxy]phenyl]methyl]-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-diene-7-carboxamide (PubChem CID 11682795) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is (2S,4R)-N-[[4-[(2S)-2,3-dihydroxypropoxy]phenyl]methyl]-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-diene-7-carboxamide.
| Compound Name | (2S,4R)-N-[[4-[(2S)-2,3-dihydroxypropoxy]phenyl]methyl]-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-diene-7-carboxamide |
|---|---|
| PubChem CID | 11682795 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (2S,4R)-N-[[4-[(2S)-2,3-dihydroxypropoxy]phenyl]methyl]-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-diene-7-carboxamide |
| SMILES | Cc1sc(C(=O)NCc2ccc(OC[C@@H](O)CO)cc2)c2c1[C@H]1[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C22H27NO4S/c1-12-18-16(8-17-19(18)22(17,2)3)20(28-12)21(26)23-9-13-4-6-15(7-5-13)27-11-14(25)10-24/h4-7,14,17,19,24-25H,8-11H2,1-3H3,(H,23,26)/t14-,17+,19+/m0/s1 |
| InChIKey | AGTSTLSNTYFQIZ-POZUXBRTSA-N |
| XLogP | 3.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |