C22H26ClNO3S — CID 163934584
(2R,5R)-N-[[2-chloro-4-(2-hydroxyethoxy)phenyl]methyl]-4,4,10-trimethyl-9-thiatricyclo[5.3.0.02,5]deca-1(10),7-diene-8-carboxamide (PubChem CID 163934584) has the molecular formula C22H26ClNO3S and a molecular weight of 419.97 g/mol. Its IUPAC name is (2R,5R)-N-[[2-chloro-4-(2-hydroxyethoxy)phenyl]methyl]-4,4,10-trimethyl-9-thiatricyclo[5.3.0.02,5]deca-1(10),7-diene-8-carboxamide.
| Compound Name | (2R,5R)-N-[[2-chloro-4-(2-hydroxyethoxy)phenyl]methyl]-4,4,10-trimethyl-9-thiatricyclo[5.3.0.02,5]deca-1(10),7-diene-8-carboxamide |
|---|---|
| PubChem CID | 163934584 |
| Molecular Formula | C22H26ClNO3S |
| Molecular Weight | 419.97 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (2R,5R)-N-[[2-chloro-4-(2-hydroxyethoxy)phenyl]methyl]-4,4,10-trimethyl-9-thiatricyclo[5.3.0.02,5]deca-1(10),7-diene-8-carboxamide |
| SMILES | Cc1sc(C(=O)NCc2ccc(OCCO)cc2Cl)c2c1[C@@H]1CC(C)(C)[C@@H]1C2 |
| InChI | InChI=1S/C22H26ClNO3S/c1-12-19-15(9-17-16(19)10-22(17,2)3)20(28-12)21(26)24-11-13-4-5-14(8-18(13)23)27-7-6-25/h4-5,8,16-17,25H,6-7,9-11H2,1-3H3,(H,24,26)/t16-,17-/m1/s1 |
| InChIKey | RLPMNOJFPYHNIE-IAGOWNOFSA-N |
| XLogP | 4.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.97 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |