C21H24ClNO4S — CID 69144944
[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl] N-[[2-chloro-4-(2-hydroxyethoxy)phenyl]methyl]carbamate (PubChem CID 69144944) has the molecular formula C21H24ClNO4S and a molecular weight of 421.95 g/mol. Its IUPAC name is [(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl] N-[[2-chloro-4-(2-hydroxyethoxy)phenyl]methyl]carbamate.
| Compound Name | [(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl] N-[[2-chloro-4-(2-hydroxyethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 69144944 |
| Molecular Formula | C21H24ClNO4S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | [(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl] N-[[2-chloro-4-(2-hydroxyethoxy)phenyl]methyl]carbamate |
| SMILES | Cc1sc(OC(=O)NCc2ccc(OCCO)cc2Cl)c2c1[C@H]1[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C21H24ClNO4S/c1-11-17-14(9-15-18(17)21(15,2)3)19(28-11)27-20(25)23-10-12-4-5-13(8-16(12)22)26-7-6-24/h4-5,8,15,18,24H,6-7,9-10H2,1-3H3,(H,23,25)/t15-,18-/m1/s1 |
| InChIKey | UZJNFEVBAFGADD-CRAIPNDOSA-N |
| XLogP | 4.67 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |