C23H27ClO3S — CID 11604128
3-[2-chloro-4-(3-hydroxypropoxy)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one (PubChem CID 11604128) has the molecular formula C23H27ClO3S and a molecular weight of 418.99 g/mol. Its IUPAC name is 3-[2-chloro-4-(3-hydroxypropoxy)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one.
| Compound Name | 3-[2-chloro-4-(3-hydroxypropoxy)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
|---|---|
| PubChem CID | 11604128 |
| Molecular Formula | C23H27ClO3S |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 3-[2-chloro-4-(3-hydroxypropoxy)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
| SMILES | Cc1sc(C(=O)CCc2ccc(OCCCO)cc2Cl)c2c1[C@H]1[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C23H27ClO3S/c1-13-20-16(12-17-21(20)23(17,2)3)22(28-13)19(26)8-6-14-5-7-15(11-18(14)24)27-10-4-9-25/h5,7,11,17,21,25H,4,6,8-10,12H2,1-3H3/t17-,21-/m1/s1 |
| InChIKey | RUBJZCXYBKEUGF-DYESRHJHSA-N |
| XLogP | 5.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|