C25H30O3S — CID 72793829
3-[3,5-dimethyl-4-(oxiran-2-ylmethoxy)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one (PubChem CID 72793829) has the molecular formula C25H30O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is 3-[3,5-dimethyl-4-(oxiran-2-ylmethoxy)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one.
| Compound Name | 3-[3,5-dimethyl-4-(oxiran-2-ylmethoxy)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
|---|---|
| PubChem CID | 72793829 |
| Molecular Formula | C25H30O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 3-[3,5-dimethyl-4-(oxiran-2-ylmethoxy)phenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
| SMILES | Cc1cc(CCC(=O)c2sc(C)c3c2C[C@@H]2[C@H]3C2(C)C)cc(C)c1OCC1CO1 |
| InChI | InChI=1S/C25H30O3S/c1-13-8-16(9-14(2)23(13)28-12-17-11-27-17)6-7-20(26)24-18-10-19-22(25(19,4)5)21(18)15(3)29-24/h8-9,17,19,22H,6-7,10-12H2,1-5H3/t17?,19-,22-/m1/s1 |
| InChIKey | RIFHKPRBGSUYER-VUVKHWMNSA-N |
| XLogP | 5.56 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|