About dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane
dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane (PubChem CID 118537099) has the molecular formula C8H7K2O3P
and a molecular weight of 260.31 g/mol. Its IUPAC name is dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane.
Molecular Properties
| Compound Name | dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane |
| PubChem CID | 118537099 |
| Molecular Formula | C8H7K2O3P |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 259.94 |
| IUPAC Name | dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane |
| SMILES | O=P([O-])([O-])/C=C/c1ccccc1.[K+].[K+] |
| InChI | InChI=1S/C8H9O3P.2K/c9-12(10,11)7-6-8-4-2-1-3-5-8;;/h1-7H,(H2,9,10,11);;/q;2*+1/p-2/b7-6+;; |
| InChIKey | VPLWIMJEIUNPRW-KMXZHCNGSA-L |
| XLogP | -5.42 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane?
The IUPAC name of dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane (CID 118537099) is dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane.
What is the SMILES notation for dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane?
The canonical SMILES for dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane is O=P([O-])([O-])/C=C/c1ccccc1.[K+].[K+].
What is the InChIKey of dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane?
The InChIKey is VPLWIMJEIUNPRW-KMXZHCNGSA-L. The full InChI is InChI=1S/C8H9O3P.2K/c9-12(10,11)7-6-8-4-2-1-3-5-8;;/h1-7H,(H2,9,10,11);;/q;2*+1/p-2/b7-6+;;.
What are the key properties of dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane?
dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane has a molecular weight of 260.31 g/mol, XLogP of -5.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;dioxido-oxo-[(E)-2-phenylethenyl]-λ5-phosphane is sourced from PubChem (CID 118537099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).