C16H32N2 — CID 118539190
1-N,1-N'-bis(prop-2-enyl)decane-1,1-diamine (PubChem CID 118539190) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 1-N,1-N'-bis(prop-2-enyl)decane-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(prop-2-enyl)decane-1,1-diamine |
|---|---|
| PubChem CID | 118539190 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 1-N,1-N'-bis(prop-2-enyl)decane-1,1-diamine |
| SMILES | C=CCNC(CCCCCCCCC)NCC=C |
| InChI | InChI=1S/C16H32N2/c1-4-7-8-9-10-11-12-13-16(17-14-5-2)18-15-6-3/h5-6,16-18H,2-4,7-15H2,1H3 |
| InChIKey | AJBURQVTJAPFEF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|