About 2-(prop-2-enylamino)tetradecane-1,1-diol
2-(prop-2-enylamino)tetradecane-1,1-diol (PubChem CID 175295299) has the molecular formula C17H35NO2
and a molecular weight of 285.47 g/mol. Its IUPAC name is 2-(prop-2-enylamino)tetradecane-1,1-diol.
Molecular Properties
| Compound Name | 2-(prop-2-enylamino)tetradecane-1,1-diol |
| PubChem CID | 175295299 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | 2-(prop-2-enylamino)tetradecane-1,1-diol |
| SMILES | C=CCNC(CCCCCCCCCCCC)C(O)O |
| InChI | InChI=1S/C17H35NO2/c1-3-5-6-7-8-9-10-11-12-13-14-16(17(19)20)18-15-4-2/h4,16-20H,2-3,5-15H2,1H3 |
| InChIKey | JSVWAMNODPURSY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(prop-2-enylamino)tetradecane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(prop-2-enylamino)tetradecane-1,1-diol?
The IUPAC name of 2-(prop-2-enylamino)tetradecane-1,1-diol (CID 175295299) is 2-(prop-2-enylamino)tetradecane-1,1-diol.
What is the SMILES notation for 2-(prop-2-enylamino)tetradecane-1,1-diol?
The canonical SMILES for 2-(prop-2-enylamino)tetradecane-1,1-diol is C=CCNC(CCCCCCCCCCCC)C(O)O.
What is the InChIKey of 2-(prop-2-enylamino)tetradecane-1,1-diol?
The InChIKey is JSVWAMNODPURSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO2/c1-3-5-6-7-8-9-10-11-12-13-14-16(17(19)20)18-15-4-2/h4,16-20H,2-3,5-15H2,1H3.
What are the key properties of 2-(prop-2-enylamino)tetradecane-1,1-diol?
2-(prop-2-enylamino)tetradecane-1,1-diol has a molecular weight of 285.47 g/mol, XLogP of 3.75, 15 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(prop-2-enylamino)tetradecane-1,1-diol is sourced from PubChem (CID 175295299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).