C9H12O5 — CID 118539355
4-hydroxy-3,4-dimethoxycyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 118539355) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is 4-hydroxy-3,4-dimethoxycyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 4-hydroxy-3,4-dimethoxycyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 118539355 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 4-hydroxy-3,4-dimethoxycyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | COC1C=C(C(=O)O)C=CC1(O)OC |
| InChI | InChI=1S/C9H12O5/c1-13-7-5-6(8(10)11)3-4-9(7,12)14-2/h3-5,7,12H,1-2H3,(H,10,11) |
| InChIKey | KIRDUGSVLBWILQ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|