C9H8O7 — CID 154496778
(3S)-2-hydroxy-3-oxalooxycyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 154496778) has the molecular formula C9H8O7 and a molecular weight of 228.16 g/mol. Its IUPAC name is (3S)-2-hydroxy-3-oxalooxycyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | (3S)-2-hydroxy-3-oxalooxycyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 154496778 |
| Molecular Formula | C9H8O7 |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | (3S)-2-hydroxy-3-oxalooxycyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | O=C(O)C(=O)O[C@H]1CC=CC(C(=O)O)=C1O |
| InChI | InChI=1S/C9H8O7/c10-6-4(7(11)12)2-1-3-5(6)16-9(15)8(13)14/h1-2,5,10H,3H2,(H,11,12)(H,13,14)/t5-/m0/s1 |
| InChIKey | YPCJAJNWGKHVRO-YFKPBYRVSA-N |
| XLogP | -0.16 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|