C17H26O — CID 118541090
1-[(2E,5Z,9Z)-2,7,8-trimethylcyclododeca-2,5,9-trien-1-yl]ethanone (PubChem CID 118541090) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-[(2E,5Z,9Z)-2,7,8-trimethylcyclododeca-2,5,9-trien-1-yl]ethanone.
| Compound Name | 1-[(2E,5Z,9Z)-2,7,8-trimethylcyclododeca-2,5,9-trien-1-yl]ethanone |
|---|---|
| PubChem CID | 118541090 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 1-[(2E,5Z,9Z)-2,7,8-trimethylcyclododeca-2,5,9-trien-1-yl]ethanone |
| SMILES | CC(=O)C1CC/C=C\C(C)C(C)/C=C\C/C=C/1C |
| InChI | InChI=1S/C17H26O/c1-13-9-5-6-11-15(3)17(16(4)18)12-8-7-10-14(13)2/h5,7,9-11,13-14,17H,6,8,12H2,1-4H3/b9-5-,10-7-,15-11+ |
| InChIKey | ZTEQNJCQZLIKKA-QJKGBGACSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|