C27H25F3N4O3S2 — CID 118543258
2,5-difluoro-N-[2-fluoro-3-(2-piperidin-4-yl-5-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]-N-(methoxymethyl)benzenesulfonamide (PubChem CID 118543258) has the molecular formula C27H25F3N4O3S2 and a molecular weight of 574.65 g/mol. Its IUPAC name is 2,5-difluoro-N-[2-fluoro-3-(2-piperidin-4-yl-5-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]-N-(methoxymethyl)benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[2-fluoro-3-(2-piperidin-4-yl-5-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]-N-(methoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118543258 |
| Molecular Formula | C27H25F3N4O3S2 |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 2,5-difluoro-N-[2-fluoro-3-(2-piperidin-4-yl-5-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]-N-(methoxymethyl)benzenesulfonamide |
| SMILES | COCN(c1cccc(-c2nc(C3CCNCC3)sc2-c2ccncc2)c1F)S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C27H25F3N4O3S2/c1-37-16-34(39(35,36)23-15-19(28)5-6-21(23)29)22-4-2-3-20(24(22)30)25-26(17-7-11-31-12-8-17)38-27(33-25)18-9-13-32-14-10-18/h2-8,11-12,15,18,32H,9-10,13-14,16H2,1H3 |
| InChIKey | JTGQUYVLETXTLH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|