C30H28ClF3N4O3S2 — CID 118543262
N-[3-[5-(2-chloro-4-pyridinyl)-2-(1-cyclopropylpiperidin-4-yl)-1,3-thiazol-4-yl]-2-fluorophenyl]-2,5-difluoro-N-(methoxymethyl)benzenesulfonamide (PubChem CID 118543262) has the molecular formula C30H28ClF3N4O3S2 and a molecular weight of 649.16 g/mol. Its IUPAC name is N-[3-[5-(2-chloro-4-pyridinyl)-2-(1-cyclopropylpiperidin-4-yl)-1,3-thiazol-4-yl]-2-fluorophenyl]-2,5-difluoro-N-(methoxymethyl)benzenesulfonamide.
| Compound Name | N-[3-[5-(2-chloro-4-pyridinyl)-2-(1-cyclopropylpiperidin-4-yl)-1,3-thiazol-4-yl]-2-fluorophenyl]-2,5-difluoro-N-(methoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118543262 |
| Molecular Formula | C30H28ClF3N4O3S2 |
| Molecular Weight | 649.16 g/mol |
| Exact Mass | 648.12 |
| IUPAC Name | N-[3-[5-(2-chloro-4-pyridinyl)-2-(1-cyclopropylpiperidin-4-yl)-1,3-thiazol-4-yl]-2-fluorophenyl]-2,5-difluoro-N-(methoxymethyl)benzenesulfonamide |
| SMILES | COCN(c1cccc(-c2nc(C3CCN(C4CC4)CC3)sc2-c2ccnc(Cl)c2)c1F)S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C30H28ClF3N4O3S2/c1-41-17-38(43(39,40)25-16-20(32)5-8-23(25)33)24-4-2-3-22(27(24)34)28-29(19-9-12-35-26(31)15-19)42-30(36-28)18-10-13-37(14-11-18)21-6-7-21/h2-5,8-9,12,15-16,18,21H,6-7,10-11,13-14,17H2,1H3 |
| InChIKey | GIRIAOJZDVMLQX-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.16 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|