C34H44N2O10 — CID 118545646
1-O-(2-methoxyethyl) 4-O-[2-[6-[[4-(6-oxoheptylcarbamoyl)benzoyl]amino]hexanoyloxy]ethyl] benzene-1,4-dicarboxylate (PubChem CID 118545646) has the molecular formula C34H44N2O10 and a molecular weight of 640.73 g/mol. Its IUPAC name is 1-O-(2-methoxyethyl) 4-O-[2-[6-[[4-(6-oxoheptylcarbamoyl)benzoyl]amino]hexanoyloxy]ethyl] benzene-1,4-dicarboxylate.
| Compound Name | 1-O-(2-methoxyethyl) 4-O-[2-[6-[[4-(6-oxoheptylcarbamoyl)benzoyl]amino]hexanoyloxy]ethyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 118545646 |
| Molecular Formula | C34H44N2O10 |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | 1-O-(2-methoxyethyl) 4-O-[2-[6-[[4-(6-oxoheptylcarbamoyl)benzoyl]amino]hexanoyloxy]ethyl] benzene-1,4-dicarboxylate |
| SMILES | COCCOC(=O)c1ccc(C(=O)OCCOC(=O)CCCCCNC(=O)c2ccc(C(=O)NCCCCCC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C34H44N2O10/c1-25(37)9-5-3-7-19-35-31(39)26-11-13-27(14-12-26)32(40)36-20-8-4-6-10-30(38)44-23-24-46-34(42)29-17-15-28(16-18-29)33(41)45-22-21-43-2/h11-18H,3-10,19-24H2,1-2H3,(H,35,39)(H,36,40) |
| InChIKey | LLCNJAQVQJJGJS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|