C29H47N3O4 — CID 153153765
4-N-[13-(methylamino)-6-oxotridecyl]-1-N-(6-oxoheptyl)benzene-1,4-dicarboxamide (PubChem CID 153153765) has the molecular formula C29H47N3O4 and a molecular weight of 501.71 g/mol. Its IUPAC name is 4-N-[13-(methylamino)-6-oxotridecyl]-1-N-(6-oxoheptyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[13-(methylamino)-6-oxotridecyl]-1-N-(6-oxoheptyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 153153765 |
| Molecular Formula | C29H47N3O4 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.36 |
| IUPAC Name | 4-N-[13-(methylamino)-6-oxotridecyl]-1-N-(6-oxoheptyl)benzene-1,4-dicarboxamide |
| SMILES | CNCCCCCCCC(=O)CCCCCNC(=O)c1ccc(C(=O)NCCCCCC(C)=O)cc1 |
| InChI | InChI=1S/C29H47N3O4/c1-24(33)14-8-6-12-22-31-28(35)25-17-19-26(20-18-25)29(36)32-23-13-7-10-16-27(34)15-9-4-3-5-11-21-30-2/h17-20,30H,3-16,21-23H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | WAZIYIZVFRTVQM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|