C27H28ClN7O5 — CID 118547842
4-[(4S,5S)-4-(4-chlorophenyl)-5-(1-methylpyrazol-3-yl)-2-(4-nitro-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one (PubChem CID 118547842) has the molecular formula C27H28ClN7O5 and a molecular weight of 566.02 g/mol. Its IUPAC name is 4-[(4S,5S)-4-(4-chlorophenyl)-5-(1-methylpyrazol-3-yl)-2-(4-nitro-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one.
| Compound Name | 4-[(4S,5S)-4-(4-chlorophenyl)-5-(1-methylpyrazol-3-yl)-2-(4-nitro-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 118547842 |
| Molecular Formula | C27H28ClN7O5 |
| Molecular Weight | 566.02 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 4-[(4S,5S)-4-(4-chlorophenyl)-5-(1-methylpyrazol-3-yl)-2-(4-nitro-2-propan-2-yloxyphenyl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one |
| SMILES | CC(C)Oc1cc([N+](=O)[O-])ccc1C1=N[C@@H](c2ccc(Cl)cc2)[C@@H](c2ccn(C)n2)N1C(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C27H28ClN7O5/c1-16(2)40-22-14-19(35(38)39)8-9-20(22)26-30-24(17-4-6-18(28)7-5-17)25(21-10-12-32(3)31-21)34(26)27(37)33-13-11-29-23(36)15-33/h4-10,12,14,16,24-25H,11,13,15H2,1-3H3,(H,29,36)/t24-,25+/m0/s1 |
| InChIKey | ZXKFGYSIUHVMNR-LOSJGSFVSA-N |
| XLogP | 3.87 |
| TPSA | 135.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.02 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|