C26H25ClN6O5S — CID 144970683
4-[4-(4-chlorophenyl)-2-(4-nitro-2-propan-2-yloxyphenyl)-5-(1,2-thiazol-3-yl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one (PubChem CID 144970683) has the molecular formula C26H25ClN6O5S and a molecular weight of 569.04 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-2-(4-nitro-2-propan-2-yloxyphenyl)-5-(1,2-thiazol-3-yl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one.
| Compound Name | 4-[4-(4-chlorophenyl)-2-(4-nitro-2-propan-2-yloxyphenyl)-5-(1,2-thiazol-3-yl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 144970683 |
| Molecular Formula | C26H25ClN6O5S |
| Molecular Weight | 569.04 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-2-(4-nitro-2-propan-2-yloxyphenyl)-5-(1,2-thiazol-3-yl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one |
| SMILES | CC(C)Oc1cc([N+](=O)[O-])ccc1C1=NC(c2ccc(Cl)cc2)C(c2ccsn2)N1C(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C26H25ClN6O5S/c1-15(2)38-21-13-18(33(36)37)7-8-19(21)25-29-23(16-3-5-17(27)6-4-16)24(20-9-12-39-30-20)32(25)26(35)31-11-10-28-22(34)14-31/h3-9,12-13,15,23-24H,10-11,14H2,1-2H3,(H,28,34) |
| InChIKey | NBVUBOSTYKEVHC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 130.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.04 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|