C27H27ClN6O5 — CID 144970676
4-[5-(4-chlorophenyl)-2-(4-nitro-2-propan-2-yloxyphenyl)-4-(1H-pyrrol-3-yl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one (PubChem CID 144970676) has the molecular formula C27H27ClN6O5 and a molecular weight of 551.00 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-2-(4-nitro-2-propan-2-yloxyphenyl)-4-(1H-pyrrol-3-yl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one.
| Compound Name | 4-[5-(4-chlorophenyl)-2-(4-nitro-2-propan-2-yloxyphenyl)-4-(1H-pyrrol-3-yl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 144970676 |
| Molecular Formula | C27H27ClN6O5 |
| Molecular Weight | 551.00 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-2-(4-nitro-2-propan-2-yloxyphenyl)-4-(1H-pyrrol-3-yl)-4,5-dihydroimidazole-1-carbonyl]piperazin-2-one |
| SMILES | CC(C)Oc1cc([N+](=O)[O-])ccc1C1=NC(c2cc[nH]c2)C(c2ccc(Cl)cc2)N1C(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C27H27ClN6O5/c1-16(2)39-22-13-20(34(37)38)7-8-21(22)26-31-24(18-9-10-29-14-18)25(17-3-5-19(28)6-4-17)33(26)27(36)32-12-11-30-23(35)15-32/h3-10,13-14,16,24-25,29H,11-12,15H2,1-2H3,(H,30,35) |
| InChIKey | XICCPAOSLFMHGV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.00 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|