C25H22N2O2S — CID 118548173
(5Z)-2-benzylimino-5-[[3-(methoxymethyl)phenyl]methylidene]-3-phenyl-1,3-thiazolidin-4-one (PubChem CID 118548173) has the molecular formula C25H22N2O2S and a molecular weight of 414.53 g/mol. Its IUPAC name is (5Z)-2-benzylimino-5-[[3-(methoxymethyl)phenyl]methylidene]-3-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-benzylimino-5-[[3-(methoxymethyl)phenyl]methylidene]-3-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118548173 |
| Molecular Formula | C25H22N2O2S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (5Z)-2-benzylimino-5-[[3-(methoxymethyl)phenyl]methylidene]-3-phenyl-1,3-thiazolidin-4-one |
| SMILES | COCc1cccc(/C=C2\S/C(=N\Cc3ccccc3)N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C25H22N2O2S/c1-29-18-21-12-8-11-20(15-21)16-23-24(28)27(22-13-6-3-7-14-22)25(30-23)26-17-19-9-4-2-5-10-19/h2-16H,17-18H2,1H3/b23-16-,26-25- |
| InChIKey | FSNVFPLQLHVQAK-JTUXUYRKSA-N |
| XLogP | 5.51 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|