C21H35N4O10P — CID 118550463
ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(2-ethoxy-2-oxoethoxy)phosphanyl]amino]-4-methylpentanoate (PubChem CID 118550463) has the molecular formula C21H35N4O10P and a molecular weight of 534.50 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(2-ethoxy-2-oxoethoxy)phosphanyl]amino]-4-methylpentanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(2-ethoxy-2-oxoethoxy)phosphanyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 118550463 |
| Molecular Formula | C21H35N4O10P |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(2-ethoxy-2-oxoethoxy)phosphanyl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)COP(N[C@@H](CC(C)C)C(=O)OCC)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H35N4O10P/c1-5-31-16(26)11-34-36(24-13(9-12(3)4)20(29)32-6-2)33-10-14-17(27)18(28)19(35-14)25-8-7-15(22)23-21(25)30/h7-8,12-14,17-19,24,27-28H,5-6,9-11H2,1-4H3,(H2,22,23,30)/t13-,14+,17+,18-,19+,36?/m0/s1 |
| InChIKey | HDFXIVMHHJDHIB-SIFNHWSVSA-N |
| XLogP | -0.16 |
| TPSA | 193.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|